What is the Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI)?

Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI) is , while it's Molecular Formula is C9H14 N2. Used in Food and Beverage Industry: Pyrazine, 2,5-dimethyl-3-propyl(8CI,9CI) is used as a flavoring agent for its characteristic warm, nutty, and slightly earthy aroma, enhancing the taste and smell of various food and beverage products. Used in Pharmaceutical Development: This chemical compound is used as a potential ingredient in the development of new pharmaceutical drugs due to its diverse properties and applications in the medical field. Used in Agrochemical Development: Pyrazine, 2,5-dimethyl-3-propyl(8CI,9CI) is also utilized in the development of new agrochemicals, where its unique properties can contribute to the effectiveness of agricultural products. Found in Natural Sources: Additionally, Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI) is naturally present in sources such as coffee, cocoa, and grilled meat, where it contributes to their distinct smell and taste.

What is the CAS number for Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI)?

The CAS number of Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI) is 18433-97-1.

What is Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI) (18433-97-1) used for?

Pyrazine, 2,5-dimethyl-3-propyl(8CI,9CI) is a pyrazine class chemical compound characterized by a pyrazine ring with two methyl groups at positions 2 and 5, and a propyl group at position 3. It is known for its warm, nutty, and slightly earthy aroma, making it a valuable component in the flavoring of food and beverages.InChI:InChI=1/C9H14N2/c1-4-5-9-8(3)10-6-7(2)11-9/h6H,4-5H2,1-3H3

What is the Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI)?

Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI) is , while it's Molecular Formula is C9H14 N2. Used in Food and Beverage Industry: Pyrazine, 2,5-dimethyl-3-propyl(8CI,9CI) is used as a flavoring agent for its characteristic warm, nutty, and slightly earthy aroma, enhancing the taste and smell of various food and beverage products. Used in Pharmaceutical Development: This chemical compound is used as a potential ingredient in the development of new pharmaceutical drugs due to its diverse properties and applications in the medical field. Used in Agrochemical Development: Pyrazine, 2,5-dimethyl-3-propyl(8CI,9CI) is also utilized in the development of new agrochemicals, where its unique properties can contribute to the effectiveness of agricultural products. Found in Natural Sources: Additionally, Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI) is naturally present in sources such as coffee, cocoa, and grilled meat, where it contributes to their distinct smell and taste.

What is the CAS number for Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI)?

The CAS number of Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI) is 18433-97-1.

What is Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI) (18433-97-1) used for?

Pyrazine, 2,5-dimethyl-3-propyl(8CI,9CI) is a pyrazine class chemical compound characterized by a pyrazine ring with two methyl groups at positions 2 and 5, and a propyl group at position 3. It is known for its warm, nutty, and slightly earthy aroma, making it a valuable component in the flavoring of food and beverages.InChI:InChI=1/C9H14N2/c1-4-5-9-8(3)10-6-7(2)11-9/h6H,4-5H2,1-3H3

Pharmaceutical

Your Location:Home > Pharmaceutical > Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI)

Product classification

Contact us

Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI)

CasNo：18433-97-1
purity：99%

Inquiry Add to cart

Details

Perfect Factory Offer Excellent quality Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI) 18433-97-1 with Safe Shipping

Molecular Formula: C9H14 N2
Molecular Weight: 150.224
Vapor Pressure: 0.311mmHg at 25°C
Boiling Point: 208.3°C at 760 mmHg
Flash Point: 77.6°C
PSA： 25.78000
Density: 0.952g/cm³
LogP: 2.04590

Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI)(Cas 18433-97-1) Usage

General Description

Pyrazine, 2,5-dimethyl-3-propyl- (8CI,9CI) is a chemical compound that belongs to the pyrazine class. It is composed of a pyrazine ring with two methyl groups at positions 2 and 5, and a propyl group at position 3. This chemical is commonly used in the food and beverage industry as a flavoring agent, providing a warm, nutty, and slightly earthy aroma. It is also found in various natural sources such as coffee, cocoa, and grilled meat, contributing to their characteristic smell and taste. Additionally, it has been identified as a potential ingredient in the development of new pharmaceutical drugs and agrochemicals due to its diverse properties and applications in different industrial fields.

InChI:InChI=1/C9H14N2/c1-4-5-9-8(3)10-6-7(2)11-9/h6H,4-5H2,1-3H3